C16H8Cl3FN2O — CID 40598251
(E)-3-(2-chloro-6-fluorophenyl)-2-cyano-N-(2,6-dichlorophenyl)prop-2-enamide (PubChem CID 40598251) has the molecular formula C16H8Cl3FN2O and a molecular weight of 369.61 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-2-cyano-N-(2,6-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-2-cyano-N-(2,6-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 40598251 |
| Molecular Formula | C16H8Cl3FN2O |
| Molecular Weight | 369.61 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-2-cyano-N-(2,6-dichlorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1c(F)cccc1Cl)C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H8Cl3FN2O/c17-11-3-2-6-14(20)10(11)7-9(8-21)16(23)22-15-12(18)4-1-5-13(15)19/h1-7H,(H,22,23)/b9-7+ |
| InChIKey | KEXMUPUEZYQHLI-VQHVLOKHSA-N |
| XLogP | 5.33 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|