C17H10Cl2N2O3 — CID 7912157
4-[(E)-2-cyano-3-(2,6-dichloroanilino)-3-oxoprop-1-enyl]benzoic acid (PubChem CID 7912157) has the molecular formula C17H10Cl2N2O3 and a molecular weight of 361.18 g/mol. Its IUPAC name is 4-[(E)-2-cyano-3-(2,6-dichloroanilino)-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[(E)-2-cyano-3-(2,6-dichloroanilino)-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 7912157 |
| Molecular Formula | C17H10Cl2N2O3 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 4-[(E)-2-cyano-3-(2,6-dichloroanilino)-3-oxoprop-1-enyl]benzoic acid |
| SMILES | N#C/C(=C\c1ccc(C(=O)O)cc1)C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H10Cl2N2O3/c18-13-2-1-3-14(19)15(13)21-16(22)12(9-20)8-10-4-6-11(7-5-10)17(23)24/h1-8H,(H,21,22)(H,23,24)/b12-8+ |
| InChIKey | HNROGRNIYVJLDO-XYOKQWHBSA-N |
| XLogP | 4.24 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|