C14H12ClFN2O3S — CID 44615006
(E)-3-(2-chloro-6-fluorophenyl)-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 44615006) has the molecular formula C14H12ClFN2O3S and a molecular weight of 342.78 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 44615006 |
| Molecular Formula | C14H12ClFN2O3S |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1c(F)cccc1Cl)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H12ClFN2O3S/c15-12-2-1-3-13(16)11(12)6-9(7-17)14(19)18-10-4-5-22(20,21)8-10/h1-3,6,10H,4-5,8H2,(H,18,19)/b9-6+ |
| InChIKey | OVYGLDPWUMNMHD-RMKNXTFCSA-N |
| XLogP | 1.69 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|