C16H18N2O4S — CID 44615442
(E)-2-cyano-N-(1,1-dioxothiolan-3-yl)-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enamide (PubChem CID 44615442) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is (E)-2-cyano-N-(1,1-dioxothiolan-3-yl)-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(1,1-dioxothiolan-3-yl)-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 44615442 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (E)-2-cyano-N-(1,1-dioxothiolan-3-yl)-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)NC2CCS(=O)(=O)C2)cc(C)c1O |
| InChI | InChI=1S/C16H18N2O4S/c1-10-5-12(6-11(2)15(10)19)7-13(8-17)16(20)18-14-3-4-23(21,22)9-14/h5-7,14,19H,3-4,9H2,1-2H3,(H,18,20)/b13-7+ |
| InChIKey | STUIZJGIASDQKG-NTUHNPAUSA-N |
| XLogP | 1.22 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|