C20H26N2O5S — CID 71952368
2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide (PubChem CID 71952368) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is 2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide.
| Compound Name | 2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 71952368 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(C=C(C#N)C(=O)NC2CCS(=O)(=O)C2)ccc1OCCC(C)C |
| InChI | InChI=1S/C20H26N2O5S/c1-14(2)6-8-27-18-5-4-15(11-19(18)26-3)10-16(12-21)20(23)22-17-7-9-28(24,25)13-17/h4-5,10-11,14,17H,6-9,13H2,1-3H3,(H,22,23) |
| InChIKey | OUCUMQYYXSFJPQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|