C20H23N2O5- — CID 7276337
(2S)-2-[4-[(Z)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]propanoate (PubChem CID 7276337) has the molecular formula C20H23N2O5- and a molecular weight of 371.41 g/mol. Its IUPAC name is (2S)-2-[4-[(Z)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]propanoate.
| Compound Name | (2S)-2-[4-[(Z)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 7276337 |
| Molecular Formula | C20H23N2O5- |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (2S)-2-[4-[(Z)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]propanoate |
| SMILES | COc1cc(/C=C(/C#N)C(=O)NC2CCCCC2)ccc1O[C@@H](C)C(=O)[O-] |
| InChI | InChI=1S/C20H24N2O5/c1-13(20(24)25)27-17-9-8-14(11-18(17)26-2)10-15(12-21)19(23)22-16-6-4-3-5-7-16/h8-11,13,16H,3-7H2,1-2H3,(H,22,23)(H,24,25)/p-1/b15-10-/t13-/m0/s1 |
| InChIKey | PDPYGSNCQMAQDU-OJNRTJSBSA-M |
| XLogP | 1.57 |
| TPSA | 111.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|