C25H25N2O5- — CID 2269013
4-[[4-[(E)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]benzoate (PubChem CID 2269013) has the molecular formula C25H25N2O5- and a molecular weight of 433.48 g/mol. Its IUPAC name is 4-[[4-[(E)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]benzoate.
| Compound Name | 4-[[4-[(E)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 2269013 |
| Molecular Formula | C25H25N2O5- |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 4-[[4-[(E)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]benzoate |
| SMILES | COc1cc(/C=C(\C#N)C(=O)NC2CCCCC2)ccc1OCc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C25H26N2O5/c1-31-23-14-18(13-20(15-26)24(28)27-21-5-3-2-4-6-21)9-12-22(23)32-16-17-7-10-19(11-8-17)25(29)30/h7-14,21H,2-6,16H2,1H3,(H,27,28)(H,29,30)/p-1/b20-13+ |
| InChIKey | APAJGWMMTSSXSI-DEDYPNTBSA-M |
| XLogP | 2.99 |
| TPSA | 111.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|