C19H22N2O5 — CID 94851253
2-[4-[(Z)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetic acid (PubChem CID 94851253) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-[4-[(Z)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 94851253 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-[4-[(Z)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=C(/C#N)C(=O)NC2CCCCC2)ccc1OCC(=O)O |
| InChI | InChI=1S/C19H22N2O5/c1-25-17-10-13(7-8-16(17)26-12-18(22)23)9-14(11-20)19(24)21-15-5-3-2-4-6-15/h7-10,15H,2-6,12H2,1H3,(H,21,24)(H,22,23)/b14-9- |
| InChIKey | IPWNRPKTVKTARI-ZROIWOOFSA-N |
| XLogP | 2.51 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|