C19H24N2O5S — CID 71952369
3-(4-butoxy-3-methoxyphenyl)-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 71952369) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is 3-(4-butoxy-3-methoxyphenyl)-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | 3-(4-butoxy-3-methoxyphenyl)-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 71952369 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 3-(4-butoxy-3-methoxyphenyl)-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | CCCCOc1ccc(C=C(C#N)C(=O)NC2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C19H24N2O5S/c1-3-4-8-26-17-6-5-14(11-18(17)25-2)10-15(12-20)19(22)21-16-7-9-27(23,24)13-16/h5-6,10-11,16H,3-4,7-9,13H2,1-2H3,(H,21,22) |
| InChIKey | RUJVNUZHZFTWFN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|