C18H14Cl2N2O4S — CID 34259129
(E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]prop-2-enamide (PubChem CID 34259129) has the molecular formula C18H14Cl2N2O4S and a molecular weight of 425.29 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 34259129 |
| Molecular Formula | C18H14Cl2N2O4S |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | (E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(-c2cc(Cl)ccc2Cl)o1)C(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H14Cl2N2O4S/c19-12-1-3-16(20)15(8-12)17-4-2-14(26-17)7-11(9-21)18(23)22-13-5-6-27(24,25)10-13/h1-4,7-8,13H,5-6,10H2,(H,22,23)/b11-7+/t13-/m0/s1 |
| InChIKey | JZTKRUIJSQQLMI-HJTPGIPUSA-N |
| XLogP | 3.46 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|