C20H18N2O5S — CID 44615310
(E)-3-[5-(4-acetylphenyl)furan-2-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 44615310) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is (E)-3-[5-(4-acetylphenyl)furan-2-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-[5-(4-acetylphenyl)furan-2-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 44615310 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | (E)-3-[5-(4-acetylphenyl)furan-2-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | CC(=O)c1ccc(-c2ccc(/C=C(\C#N)C(=O)NC3CCS(=O)(=O)C3)o2)cc1 |
| InChI | InChI=1S/C20H18N2O5S/c1-13(23)14-2-4-15(5-3-14)19-7-6-18(27-19)10-16(11-21)20(24)22-17-8-9-28(25,26)12-17/h2-7,10,17H,8-9,12H2,1H3,(H,22,24)/b16-10+ |
| InChIKey | FRDOMBXSDSLOCO-MHWRWJLKSA-N |
| XLogP | 2.36 |
| TPSA | 117.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|