C18H15BrN2O4S — CID 3583813
3-[5-(3-bromophenyl)furan-2-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 3583813) has the molecular formula C18H15BrN2O4S and a molecular weight of 435.30 g/mol. Its IUPAC name is 3-[5-(3-bromophenyl)furan-2-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | 3-[5-(3-bromophenyl)furan-2-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3583813 |
| Molecular Formula | C18H15BrN2O4S |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | 3-[5-(3-bromophenyl)furan-2-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-c2cccc(Br)c2)o1)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H15BrN2O4S/c19-14-3-1-2-12(8-14)17-5-4-16(25-17)9-13(10-20)18(22)21-15-6-7-26(23,24)11-15/h1-5,8-9,15H,6-7,11H2,(H,21,22) |
| InChIKey | URAFBPOUDKQEHT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|