C15H10BrN3O3 — CID 126239072
(Z)-3-[5-(3-bromophenyl)furan-2-yl]-N-carbamoyl-2-cyanoprop-2-enamide (PubChem CID 126239072) has the molecular formula C15H10BrN3O3 and a molecular weight of 360.17 g/mol. Its IUPAC name is (Z)-3-[5-(3-bromophenyl)furan-2-yl]-N-carbamoyl-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[5-(3-bromophenyl)furan-2-yl]-N-carbamoyl-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126239072 |
| Molecular Formula | C15H10BrN3O3 |
| Molecular Weight | 360.17 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | (Z)-3-[5-(3-bromophenyl)furan-2-yl]-N-carbamoyl-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(-c2cccc(Br)c2)o1)C(=O)NC(N)=O |
| InChI | InChI=1S/C15H10BrN3O3/c16-11-3-1-2-9(6-11)13-5-4-12(22-13)7-10(8-17)14(20)19-15(18)21/h1-7H,(H3,18,19,20,21)/b10-7- |
| InChIKey | IWGQCXCOZFKYHG-YFHOEESVSA-N |
| XLogP | 2.81 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.17 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|