C16H15Cl2N3O3S2 — CID 2852545
1-[[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-3-(1,1-dioxothiolan-3-yl)thiourea (PubChem CID 2852545) has the molecular formula C16H15Cl2N3O3S2 and a molecular weight of 432.35 g/mol. Its IUPAC name is 1-[[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-3-(1,1-dioxothiolan-3-yl)thiourea.
| Compound Name | 1-[[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-3-(1,1-dioxothiolan-3-yl)thiourea |
|---|---|
| PubChem CID | 2852545 |
| Molecular Formula | C16H15Cl2N3O3S2 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | 1-[[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-3-(1,1-dioxothiolan-3-yl)thiourea |
| SMILES | O=S1(=O)CCC(NC(=S)NN=Cc2ccc(-c3cc(Cl)ccc3Cl)o2)C1 |
| InChI | InChI=1S/C16H15Cl2N3O3S2/c17-10-1-3-14(18)13(7-10)15-4-2-12(24-15)8-19-21-16(25)20-11-5-6-26(22,23)9-11/h1-4,7-8,11H,5-6,9H2,(H2,20,21,25) |
| InChIKey | YWRVNCXMBOPJLM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|