C12H13ClFN3O2S2 — CID 2852263
1-[(2-chloro-6-fluorophenyl)methylideneamino]-3-(1,1-dioxothiolan-3-yl)thiourea (PubChem CID 2852263) has the molecular formula C12H13ClFN3O2S2 and a molecular weight of 349.84 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methylideneamino]-3-(1,1-dioxothiolan-3-yl)thiourea.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methylideneamino]-3-(1,1-dioxothiolan-3-yl)thiourea |
|---|---|
| PubChem CID | 2852263 |
| Molecular Formula | C12H13ClFN3O2S2 |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methylideneamino]-3-(1,1-dioxothiolan-3-yl)thiourea |
| SMILES | O=S1(=O)CCC(NC(=S)NN=Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C12H13ClFN3O2S2/c13-10-2-1-3-11(14)9(10)6-15-17-12(20)16-8-4-5-21(18,19)7-8/h1-3,6,8H,4-5,7H2,(H2,16,17,20) |
| InChIKey | LXFOTJDQHVRWCT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|