C22H16Cl2N4O5S — CID 6891144
(E)-2-cyano-3-[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]prop-2-enamide (PubChem CID 6891144) has the molecular formula C22H16Cl2N4O5S and a molecular weight of 519.37 g/mol. Its IUPAC name is (E)-2-cyano-3-[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6891144 |
| Molecular Formula | C22H16Cl2N4O5S |
| Molecular Weight | 519.37 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | (E)-2-cyano-3-[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1c(Oc2ccc(Cl)cc2Cl)nc2ccccn2c1=O)C(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H16Cl2N4O5S/c23-14-4-5-18(17(24)10-14)33-21-16(22(30)28-7-2-1-3-19(28)27-21)9-13(11-25)20(29)26-15-6-8-34(31,32)12-15/h1-5,7,9-10,15H,6,8,12H2,(H,26,29)/b13-9+/t15-/m0/s1 |
| InChIKey | GLRPGNFOWKEXCY-GLNPCMGASA-N |
| XLogP | 3.00 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|