C23H20N4O5S — CID 4014916
2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[2-(3-methylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide (PubChem CID 4014916) has the molecular formula C23H20N4O5S and a molecular weight of 464.50 g/mol. Its IUPAC name is 2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[2-(3-methylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[2-(3-methylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4014916 |
| Molecular Formula | C23H20N4O5S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 2-cyano-N-(1,1-dioxothiolan-3-yl)-3-[2-(3-methylphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide |
| SMILES | Cc1cccc(Oc2nc3ccccn3c(=O)c2C=C(C#N)C(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C23H20N4O5S/c1-15-5-4-6-18(11-15)32-22-19(23(29)27-9-3-2-7-20(27)26-22)12-16(13-24)21(28)25-17-8-10-33(30,31)14-17/h2-7,9,11-12,17H,8,10,14H2,1H3,(H,25,28) |
| InChIKey | GIWBBNTXTJTIQG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|