C23H19ClN4O3 — CID 3994347
3-[2-(4-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-cyano-N-cyclopentylprop-2-enamide (PubChem CID 3994347) has the molecular formula C23H19ClN4O3 and a molecular weight of 434.88 g/mol. Its IUPAC name is 3-[2-(4-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-cyano-N-cyclopentylprop-2-enamide.
| Compound Name | 3-[2-(4-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-cyano-N-cyclopentylprop-2-enamide |
|---|---|
| PubChem CID | 3994347 |
| Molecular Formula | C23H19ClN4O3 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 3-[2-(4-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-cyano-N-cyclopentylprop-2-enamide |
| SMILES | N#CC(=Cc1c(Oc2ccc(Cl)cc2)nc2ccccn2c1=O)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C23H19ClN4O3/c24-16-8-10-18(11-9-16)31-22-19(23(30)28-12-4-3-7-20(28)27-22)13-15(14-25)21(29)26-17-5-1-2-6-17/h3-4,7-13,17H,1-2,5-6H2,(H,26,29) |
| InChIKey | DNWJXHBEQOIVSZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|