C25H17ClN4O4 — CID 2016642
(E)-3-[2-(4-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide (PubChem CID 2016642) has the molecular formula C25H17ClN4O4 and a molecular weight of 472.89 g/mol. Its IUPAC name is (E)-3-[2-(4-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[2-(4-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2016642 |
| Molecular Formula | C25H17ClN4O4 |
| Molecular Weight | 472.89 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | (E)-3-[2-(4-chlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C/c2c(Oc3ccc(Cl)cc3)nc3ccccn3c2=O)cc1 |
| InChI | InChI=1S/C25H17ClN4O4/c1-33-19-11-7-18(8-12-19)28-23(31)16(15-27)14-21-24(34-20-9-5-17(26)6-10-20)29-22-4-2-3-13-30(22)25(21)32/h2-14H,1H3,(H,28,31)/b16-14+ |
| InChIKey | KCSCEAXFCJWQSW-JQIJEIRASA-N |
| XLogP | 4.69 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.89 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|