C22H15Cl2N3O5S3 — CID 18817041
(5E)-5-[[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18817041) has the molecular formula C22H15Cl2N3O5S3 and a molecular weight of 568.49 g/mol. Its IUPAC name is (5E)-5-[[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18817041 |
| Molecular Formula | C22H15Cl2N3O5S3 |
| Molecular Weight | 568.49 g/mol |
| Exact Mass | 566.96 |
| IUPAC Name | (5E)-5-[[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2c(Oc3ccc(Cl)cc3Cl)nc3ccccn3c2=O)SC(=S)N1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H15Cl2N3O5S3/c23-12-4-5-16(15(24)9-12)32-19-14(20(28)26-7-2-1-3-18(26)25-19)10-17-21(29)27(22(33)34-17)13-6-8-35(30,31)11-13/h1-5,7,9-10,13H,6,8,11H2/b17-10+ |
| InChIKey | ZUSJBAODKJRJDD-LICLKQGHSA-N |
| XLogP | 4.18 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|