C20H22N4O4S3 — CID 18805925
(5E)-3-(1,1-dioxothiolan-3-yl)-5-[[2-(2-methylpropylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18805925) has the molecular formula C20H22N4O4S3 and a molecular weight of 478.62 g/mol. Its IUPAC name is (5E)-3-(1,1-dioxothiolan-3-yl)-5-[[2-(2-methylpropylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(1,1-dioxothiolan-3-yl)-5-[[2-(2-methylpropylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18805925 |
| Molecular Formula | C20H22N4O4S3 |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | (5E)-3-(1,1-dioxothiolan-3-yl)-5-[[2-(2-methylpropylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)CNc1nc2ccccn2c(=O)c1/C=C1/SC(=S)N(C2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C20H22N4O4S3/c1-12(2)10-21-17-14(18(25)23-7-4-3-5-16(23)22-17)9-15-19(26)24(20(29)30-15)13-6-8-31(27,28)11-13/h3-5,7,9,12-13,21H,6,8,10-11H2,1-2H3/b15-9+ |
| InChIKey | JAYYCKRQEWIZOO-OQLLNIDSSA-N |
| XLogP | 2.15 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|