C25H24N4O2S2 — CID 2285461
(5Z)-5-[[2-(benzylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-cyclohexyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2285461) has the molecular formula C25H24N4O2S2 and a molecular weight of 476.63 g/mol. Its IUPAC name is (5Z)-5-[[2-(benzylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-cyclohexyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[2-(benzylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-cyclohexyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2285461 |
| Molecular Formula | C25H24N4O2S2 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (5Z)-5-[[2-(benzylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-cyclohexyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2c(NCc3ccccc3)nc3ccccn3c2=O)SC(=S)N1C1CCCCC1 |
| InChI | InChI=1S/C25H24N4O2S2/c30-23-19(15-20-24(31)29(25(32)33-20)18-11-5-2-6-12-18)22(26-16-17-9-3-1-4-10-17)27-21-13-7-8-14-28(21)23/h1,3-4,7-10,13-15,18,26H,2,5-6,11-12,16H2/b20-15- |
| InChIKey | VPGOQTBDQDPDOQ-HKWRFOASSA-N |
| XLogP | 4.84 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|