C28H28N4O4S3 — CID 22530073
(5E)-5-[[2-(4-benzylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 22530073) has the molecular formula C28H28N4O4S3 and a molecular weight of 580.76 g/mol. Its IUPAC name is (5E)-5-[[2-(4-benzylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-(4-benzylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 22530073 |
| Molecular Formula | C28H28N4O4S3 |
| Molecular Weight | 580.76 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | (5E)-5-[[2-(4-benzylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-(1,1-dioxothiolan-3-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2c(N3CCC(Cc4ccccc4)CC3)nc3ccccn3c2=O)SC(=S)N1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C28H28N4O4S3/c33-26-22(17-23-27(34)32(28(37)38-23)21-11-15-39(35,36)18-21)25(29-24-8-4-5-12-31(24)26)30-13-9-20(10-14-30)16-19-6-2-1-3-7-19/h1-8,12,17,20-21H,9-11,13-16,18H2/b23-17+ |
| InChIKey | KKXSBJHUKZZSJR-HAVVHWLPSA-N |
| XLogP | 3.54 |
| TPSA | 92.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|