C32H30N4O3S2 — CID 5254378
5-[[2-(4-benzylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5254378) has the molecular formula C32H30N4O3S2 and a molecular weight of 582.75 g/mol. Its IUPAC name is 5-[[2-(4-benzylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-(4-benzylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5254378 |
| Molecular Formula | C32H30N4O3S2 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | 5-[[2-(4-benzylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CN2C(=O)C(=Cc3c(N4CCC(Cc5ccccc5)CC4)nc4ccccn4c3=O)SC2=S)cc1 |
| InChI | InChI=1S/C32H30N4O3S2/c1-39-25-12-10-24(11-13-25)21-36-31(38)27(41-32(36)40)20-26-29(33-28-9-5-6-16-35(28)30(26)37)34-17-14-23(15-18-34)19-22-7-3-2-4-8-22/h2-13,16,20,23H,14-15,17-19,21H2,1H3 |
| InChIKey | BZMNJMFVFVYHAU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|