C23H20N4O2S3 — CID 3733903
3-benzyl-5-[(4-oxo-2-thiomorpholin-4-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3733903) has the molecular formula C23H20N4O2S3 and a molecular weight of 480.64 g/mol. Its IUPAC name is 3-benzyl-5-[(4-oxo-2-thiomorpholin-4-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-benzyl-5-[(4-oxo-2-thiomorpholin-4-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3733903 |
| Molecular Formula | C23H20N4O2S3 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 3-benzyl-5-[(4-oxo-2-thiomorpholin-4-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2c(N3CCSCC3)nc3ccccn3c2=O)SC(=S)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H20N4O2S3/c28-21-17(14-18-22(29)27(23(30)32-18)15-16-6-2-1-3-7-16)20(25-10-12-31-13-11-25)24-19-8-4-5-9-26(19)21/h1-9,14H,10-13,15H2 |
| InChIKey | XOAWWCGRIHJJIG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|