C22H25N5O5S3 — CID 5117979
3-(1,1-dioxothiolan-3-yl)-5-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5117979) has the molecular formula C22H25N5O5S3 and a molecular weight of 535.67 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-5-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-5-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5117979 |
| Molecular Formula | C22H25N5O5S3 |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-5-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2c(N3CCN(CCO)CC3)nc3ccccn3c2=O)SC(=S)N1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H25N5O5S3/c28-11-10-24-6-8-25(9-7-24)19-16(20(29)26-5-2-1-3-18(26)23-19)13-17-21(30)27(22(33)34-17)15-4-12-35(31,32)14-15/h1-3,5,13,15,28H,4,6-12,14H2 |
| InChIKey | SYIYIVBCRQXCCR-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|