C23H25N5O5S3 — CID 3351456
1-[3-[[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl]piperidine-4-carboxamide (PubChem CID 3351456) has the molecular formula C23H25N5O5S3 and a molecular weight of 547.68 g/mol. Its IUPAC name is 1-[3-[[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3351456 |
| Molecular Formula | C23H25N5O5S3 |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 1-[3-[[3-(1,1-dioxothiolan-3-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl]piperidine-4-carboxamide |
| SMILES | Cc1ccc2nc(N3CCC(C(N)=O)CC3)c(C=C3SC(=S)N(C4CCS(=O)(=O)C4)C3=O)c(=O)n2c1 |
| InChI | InChI=1S/C23H25N5O5S3/c1-13-2-3-18-25-20(26-7-4-14(5-8-26)19(24)29)16(21(30)27(18)11-13)10-17-22(31)28(23(34)35-17)15-6-9-36(32,33)12-15/h2-3,10-11,14-15H,4-9,12H2,1H3,(H2,24,29) |
| InChIKey | XNQSKUKXRZOABM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|