C21H22N4O4S3 — CID 2292733
(5Z)-3-[(3R)-1,1-dioxothiolan-3-yl]-5-[(4-oxo-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2292733) has the molecular formula C21H22N4O4S3 and a molecular weight of 490.63 g/mol. Its IUPAC name is (5Z)-3-[(3R)-1,1-dioxothiolan-3-yl]-5-[(4-oxo-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[(3R)-1,1-dioxothiolan-3-yl]-5-[(4-oxo-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2292733 |
| Molecular Formula | C21H22N4O4S3 |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | (5Z)-3-[(3R)-1,1-dioxothiolan-3-yl]-5-[(4-oxo-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2c(N3CCCCC3)nc3ccccn3c2=O)SC(=S)N1[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H22N4O4S3/c26-19-15(12-16-20(27)25(21(30)31-16)14-7-11-32(28,29)13-14)18(23-8-3-1-4-9-23)22-17-6-2-5-10-24(17)19/h2,5-6,10,12,14H,1,3-4,7-9,11,13H2/b16-12-/t14-/m1/s1 |
| InChIKey | FEPUETDKRKKECF-IZCBMXNHSA-N |
| XLogP | 2.07 |
| TPSA | 92.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|