C18H22N4O3S — CID 92846363
3-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 92846363) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is 3-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 92846363 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-[[(3S)-1,1-dioxothiolan-3-yl]iminomethyl]-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c(/C=N/[C@H]2CCS(=O)(=O)C2)c(N2CCCCC2)nc2ccccn12 |
| InChI | InChI=1S/C18H22N4O3S/c23-18-15(12-19-14-7-11-26(24,25)13-14)17(21-8-3-1-4-9-21)20-16-6-2-5-10-22(16)18/h2,5-6,10,12,14H,1,3-4,7-9,11,13H2/b19-12+/t14-/m0/s1 |
| InChIKey | NSZAXBBWCVHBLT-BXUJETTOSA-N |
| XLogP | 1.29 |
| TPSA | 84.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|