C21H21N5O3 — CID 4572522
2-hydroxy-N-[(4-oxo-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylideneamino]benzamide (PubChem CID 4572522) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-hydroxy-N-[(4-oxo-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylideneamino]benzamide.
| Compound Name | 2-hydroxy-N-[(4-oxo-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 4572522 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-hydroxy-N-[(4-oxo-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1c(N2CCCCC2)nc2ccccn2c1=O)c1ccccc1O |
| InChI | InChI=1S/C21H21N5O3/c27-17-9-3-2-8-15(17)20(28)24-22-14-16-19(25-11-5-1-6-12-25)23-18-10-4-7-13-26(18)21(16)29/h2-4,7-10,13-14,27H,1,5-6,11-12H2,(H,24,28) |
| InChIKey | DJFPNUIRCFBQIC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 99.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|