C24H27N5O3 — CID 71952781
N-[[2-(2-ethylpiperidin-1-yl)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]-2-hydroxybenzamide (PubChem CID 71952781) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[[2-(2-ethylpiperidin-1-yl)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]-2-hydroxybenzamide.
| Compound Name | N-[[2-(2-ethylpiperidin-1-yl)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 71952781 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-[[2-(2-ethylpiperidin-1-yl)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]-2-hydroxybenzamide |
| SMILES | CCC1CCCCN1c1nc2ccc(C)cn2c(=O)c1C=NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C24H27N5O3/c1-3-17-8-6-7-13-28(17)22-19(24(32)29-15-16(2)11-12-21(29)26-22)14-25-27-23(31)18-9-4-5-10-20(18)30/h4-5,9-12,14-15,17,30H,3,6-8,13H2,1-2H3,(H,27,31) |
| InChIKey | FIAITHMJXJMAJH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 99.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|