C16H20N6OS — CID 6138228
[(Z)-[2-(4-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]thiourea (PubChem CID 6138228) has the molecular formula C16H20N6OS and a molecular weight of 344.44 g/mol. Its IUPAC name is [(Z)-[2-(4-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]thiourea.
| Compound Name | [(Z)-[2-(4-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 6138228 |
| Molecular Formula | C16H20N6OS |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [(Z)-[2-(4-methylpiperidin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]thiourea |
| SMILES | CC1CCN(c2nc3ccccn3c(=O)c2/C=N\NC(N)=S)CC1 |
| InChI | InChI=1S/C16H20N6OS/c1-11-5-8-21(9-6-11)14-12(10-18-20-16(17)24)15(23)22-7-3-2-4-13(22)19-14/h2-4,7,10-11H,5-6,8-9H2,1H3,(H3,17,20,24)/b18-10- |
| InChIKey | QJIWLGONWOSSHG-ZDLGFXPLSA-N |
| XLogP | 1.10 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|