C22H22N6O5 — CID 92641097
N-[(Z)-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]-3-nitrobenzamide (PubChem CID 92641097) has the molecular formula C22H22N6O5 and a molecular weight of 450.46 g/mol. Its IUPAC name is N-[(Z)-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(Z)-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 92641097 |
| Molecular Formula | C22H22N6O5 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-[(Z)-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]-3-nitrobenzamide |
| SMILES | C[C@@H]1CN(c2nc3ccccn3c(=O)c2/C=N\NC(=O)c2cccc([N+](=O)[O-])c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C22H22N6O5/c1-14-12-26(13-15(2)33-14)20-18(22(30)27-9-4-3-8-19(27)24-20)11-23-25-21(29)16-6-5-7-17(10-16)28(31)32/h3-11,14-15H,12-13H2,1-2H3,(H,25,29)/b23-11-/t14-,15-/m1/s1 |
| InChIKey | NBTNWAQPHPOOTR-LOLMRRMXSA-N |
| XLogP | 1.98 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|