C18H19N5O3 — CID 7460369
(E)-2-cyano-3-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide (PubChem CID 7460369) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is (E)-2-cyano-3-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 7460369 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (E)-2-cyano-3-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide |
| SMILES | C[C@H]1CN(c2nc3ccccn3c(=O)c2/C=C(\C#N)C(N)=O)C[C@H](C)O1 |
| InChI | InChI=1S/C18H19N5O3/c1-11-9-22(10-12(2)26-11)17-14(7-13(8-19)16(20)24)18(25)23-6-4-3-5-15(23)21-17/h3-7,11-12H,9-10H2,1-2H3,(H2,20,24)/b13-7+/t11-,12-/m0/s1 |
| InChIKey | JRNPIVZDDPZRMJ-LSHIQYPYSA-N |
| XLogP | 0.70 |
| TPSA | 113.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|