C25H31N5O5 — CID 4502795
2-cyano-3-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(3-propan-2-yloxypropyl)prop-2-enamide (PubChem CID 4502795) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is 2-cyano-3-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(3-propan-2-yloxypropyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(3-propan-2-yloxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 4502795 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 2-cyano-3-[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(3-propan-2-yloxypropyl)prop-2-enamide |
| SMILES | CC(C)OCCCNC(=O)C(C#N)=Cc1c(N2CCC3(CC2)OCCO3)nc2ccccn2c1=O |
| InChI | InChI=1S/C25H31N5O5/c1-18(2)33-13-5-9-27-23(31)19(17-26)16-20-22(28-21-6-3-4-10-30(21)24(20)32)29-11-7-25(8-12-29)34-14-15-35-25/h3-4,6,10,16,18H,5,7-9,11-15H2,1-2H3,(H,27,31) |
| InChIKey | UZRCFFXYLXDBIA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 118.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|