C24H30N4O3S2 — CID 18805345
(5E)-5-[[2-(2,6-dimethylmorpholin-4-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-hexyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18805345) has the molecular formula C24H30N4O3S2 and a molecular weight of 486.66 g/mol. Its IUPAC name is (5E)-5-[[2-(2,6-dimethylmorpholin-4-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-hexyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-(2,6-dimethylmorpholin-4-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-hexyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18805345 |
| Molecular Formula | C24H30N4O3S2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (5E)-5-[[2-(2,6-dimethylmorpholin-4-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-hexyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCCCN1C(=O)/C(=C\c2c(N3CC(C)OC(C)C3)nc3ccccn3c2=O)SC1=S |
| InChI | InChI=1S/C24H30N4O3S2/c1-4-5-6-8-12-28-23(30)19(33-24(28)32)13-18-21(26-14-16(2)31-17(3)15-26)25-20-10-7-9-11-27(20)22(18)29/h7,9-11,13,16-17H,4-6,8,12,14-15H2,1-3H3/b19-13+ |
| InChIKey | NHOUIUCCNWWMLS-CPNJWEJPSA-N |
| XLogP | 4.09 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|