C23H28N4O2S2 — CID 3348170
3-heptyl-5-[(4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3348170) has the molecular formula C23H28N4O2S2 and a molecular weight of 456.64 g/mol. Its IUPAC name is 3-heptyl-5-[(4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-heptyl-5-[(4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3348170 |
| Molecular Formula | C23H28N4O2S2 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 3-heptyl-5-[(4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCN1C(=O)C(=Cc2c(N3CCCC3)nc3ccccn3c2=O)SC1=S |
| InChI | InChI=1S/C23H28N4O2S2/c1-2-3-4-5-7-15-27-22(29)18(31-23(27)30)16-17-20(25-12-9-10-13-25)24-19-11-6-8-14-26(19)21(17)28/h6,8,11,14,16H,2-5,7,9-10,12-13,15H2,1H3 |
| InChIKey | BUENXWTYRBUBIS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|