C16H16N4O — CID 84818371
(E)-3-(4-oxo-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)prop-2-enenitrile (PubChem CID 84818371) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is (E)-3-(4-oxo-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-oxo-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 84818371 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (E)-3-(4-oxo-2-piperidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)prop-2-enenitrile |
| SMILES | N#C/C=C/c1c(N2CCCCC2)nc2ccccn2c1=O |
| InChI | InChI=1S/C16H16N4O/c17-9-6-7-13-15(19-10-3-1-4-11-19)18-14-8-2-5-12-20(14)16(13)21/h2,5-8,12H,1,3-4,10-11H2/b7-6+ |
| InChIKey | RNALXLOIHLDYDY-VOTSOKGWSA-N |
| XLogP | 2.22 |
| TPSA | 61.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|