C21H20N5O3- — CID 7689875
2-[(2Z)-2-[(9-methyl-4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]hydrazinyl]benzoate (PubChem CID 7689875) has the molecular formula C21H20N5O3- and a molecular weight of 390.42 g/mol. Its IUPAC name is 2-[(2Z)-2-[(9-methyl-4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]hydrazinyl]benzoate.
| Compound Name | 2-[(2Z)-2-[(9-methyl-4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7689875 |
| Molecular Formula | C21H20N5O3- |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-[(2Z)-2-[(9-methyl-4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]hydrazinyl]benzoate |
| SMILES | Cc1cccn2c(=O)c(/C=N\Nc3ccccc3C(=O)[O-])c(N3CCCC3)nc12 |
| InChI | InChI=1S/C21H21N5O3/c1-14-7-6-12-26-18(14)23-19(25-10-4-5-11-25)16(20(26)27)13-22-24-17-9-3-2-8-15(17)21(28)29/h2-3,6-9,12-13,24H,4-5,10-11H2,1H3,(H,28,29)/p-1/b22-13- |
| InChIKey | VBUCLKDEOXLOLY-XKZIYDEJSA-M |
| XLogP | 1.41 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|