C17H15N5O2 — CID 950449
2-[(9-methyl-2-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidin-3-yl)methylidene]propanedinitrile (PubChem CID 950449) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-[(9-methyl-2-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidin-3-yl)methylidene]propanedinitrile.
| Compound Name | 2-[(9-methyl-2-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidin-3-yl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 950449 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-[(9-methyl-2-morpholin-4-yl-4-oxopyrido[1,2-a]pyrimidin-3-yl)methylidene]propanedinitrile |
| SMILES | Cc1cccn2c(=O)c(C=C(C#N)C#N)c(N3CCOCC3)nc12 |
| InChI | InChI=1S/C17H15N5O2/c1-12-3-2-4-22-15(12)20-16(21-5-7-24-8-6-21)14(17(22)23)9-13(10-18)11-19/h2-4,9H,5-8H2,1H3 |
| InChIKey | HHTZOUQLVZYKFI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 94.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|