C23H28N6O2 — CID 5113224
3-[9-methyl-2-(4-methylpiperazin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile (PubChem CID 5113224) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 3-[9-methyl-2-(4-methylpiperazin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | 3-[9-methyl-2-(4-methylpiperazin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5113224 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 3-[9-methyl-2-(4-methylpiperazin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1cccn2c(=O)c(C=C(C#N)C(=O)N3CCCCC3)c(N3CCN(C)CC3)nc12 |
| InChI | InChI=1S/C23H28N6O2/c1-17-7-6-10-29-20(17)25-21(27-13-11-26(2)12-14-27)19(23(29)31)15-18(16-24)22(30)28-8-4-3-5-9-28/h6-7,10,15H,3-5,8-9,11-14H2,1-2H3 |
| InChIKey | ORTKCDNRMHWDJT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|