C24H24N4O3S — CID 4886718
3-[2-(azepan-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(benzenesulfonyl)prop-2-enenitrile (PubChem CID 4886718) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(benzenesulfonyl)prop-2-enenitrile.
| Compound Name | 3-[2-(azepan-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(benzenesulfonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4886718 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3-[2-(azepan-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(benzenesulfonyl)prop-2-enenitrile |
| SMILES | Cc1cccn2c(=O)c(C=C(C#N)S(=O)(=O)c3ccccc3)c(N3CCCCCC3)nc12 |
| InChI | InChI=1S/C24H24N4O3S/c1-18-10-9-15-28-22(18)26-23(27-13-7-2-3-8-14-27)21(24(28)29)16-20(17-25)32(30,31)19-11-5-4-6-12-19/h4-6,9-12,15-16H,2-3,7-8,13-14H2,1H3 |
| InChIKey | QRVOUWRGIMSEHW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 95.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|