C24H15Cl2N3O4S — CID 1290522
(E)-2-(benzenesulfonyl)-3-[2-(2,4-dichlorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile (PubChem CID 1290522) has the molecular formula C24H15Cl2N3O4S and a molecular weight of 512.37 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-3-[2-(2,4-dichlorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(benzenesulfonyl)-3-[2-(2,4-dichlorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 1290522 |
| Molecular Formula | C24H15Cl2N3O4S |
| Molecular Weight | 512.37 g/mol |
| Exact Mass | 511.02 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-3-[2-(2,4-dichlorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile |
| SMILES | Cc1cccn2c(=O)c(/C=C(\C#N)S(=O)(=O)c3ccccc3)c(Oc3ccc(Cl)cc3Cl)nc12 |
| InChI | InChI=1S/C24H15Cl2N3O4S/c1-15-6-5-11-29-22(15)28-23(33-21-10-9-16(25)12-20(21)26)19(24(29)30)13-18(14-27)34(31,32)17-7-3-2-4-8-17/h2-13H,1H3/b18-13+ |
| InChIKey | UBRBARFDVFZBDC-QGOAFFKASA-N |
| XLogP | 5.44 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.37 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|