C19H12Cl2N4O3 — CID 6186772
(E)-2-cyano-3-[2-(2,4-dichlorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide (PubChem CID 6186772) has the molecular formula C19H12Cl2N4O3 and a molecular weight of 415.24 g/mol. Its IUPAC name is (E)-2-cyano-3-[2-(2,4-dichlorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[2-(2,4-dichlorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6186772 |
| Molecular Formula | C19H12Cl2N4O3 |
| Molecular Weight | 415.24 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | (E)-2-cyano-3-[2-(2,4-dichlorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide |
| SMILES | Cc1cccn2c(=O)c(/C=C(\C#N)C(N)=O)c(Oc3ccc(Cl)cc3Cl)nc12 |
| InChI | InChI=1S/C19H12Cl2N4O3/c1-10-3-2-6-25-17(10)24-18(28-15-5-4-12(20)8-14(15)21)13(19(25)27)7-11(9-22)16(23)26/h2-8H,1H3,(H2,23,26)/b11-7+ |
| InChIKey | GFUSEZUSQBSRRW-YRNVUSSQSA-N |
| XLogP | 3.49 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.24 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|