C25H23ClN4O3 — CID 3578003
3-[2-(4-chloro-3-methylphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile (PubChem CID 3578003) has the molecular formula C25H23ClN4O3 and a molecular weight of 462.94 g/mol. Its IUPAC name is 3-[2-(4-chloro-3-methylphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | 3-[2-(4-chloro-3-methylphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3578003 |
| Molecular Formula | C25H23ClN4O3 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 3-[2-(4-chloro-3-methylphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-2-(piperidine-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1cc(Oc2nc3c(C)cccn3c(=O)c2C=C(C#N)C(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C25H23ClN4O3/c1-16-7-6-12-30-22(16)28-23(33-19-8-9-21(26)17(2)13-19)20(25(30)32)14-18(15-27)24(31)29-10-4-3-5-11-29/h6-9,12-14H,3-5,10-11H2,1-2H3 |
| InChIKey | VACFRJRMLFPMJB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 87.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|