C24H15BrClN3O4S — CID 4729346
2-(4-bromophenyl)sulfonyl-3-[2-(4-chlorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile (PubChem CID 4729346) has the molecular formula C24H15BrClN3O4S and a molecular weight of 556.83 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfonyl-3-[2-(4-chlorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile.
| Compound Name | 2-(4-bromophenyl)sulfonyl-3-[2-(4-chlorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4729346 |
| Molecular Formula | C24H15BrClN3O4S |
| Molecular Weight | 556.83 g/mol |
| Exact Mass | 554.97 |
| IUPAC Name | 2-(4-bromophenyl)sulfonyl-3-[2-(4-chlorophenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile |
| SMILES | Cc1cccn2c(=O)c(C=C(C#N)S(=O)(=O)c3ccc(Br)cc3)c(Oc3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C24H15BrClN3O4S/c1-15-3-2-12-29-22(15)28-23(33-18-8-6-17(26)7-9-18)21(24(29)30)13-20(14-27)34(31,32)19-10-4-16(25)5-11-19/h2-13H,1H3 |
| InChIKey | DGYGUMIYQIMUMK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.83 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|