C24H16ClN3O5S — CID 2950236
2-(4-chlorophenyl)sulfonyl-3-[2-(4-methoxyphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile (PubChem CID 2950236) has the molecular formula C24H16ClN3O5S and a molecular weight of 493.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-3-[2-(4-methoxyphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-3-[2-(4-methoxyphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2950236 |
| Molecular Formula | C24H16ClN3O5S |
| Molecular Weight | 493.93 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-3-[2-(4-methoxyphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enenitrile |
| SMILES | COc1ccc(Oc2nc3ccccn3c(=O)c2C=C(C#N)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H16ClN3O5S/c1-32-17-7-9-18(10-8-17)33-23-21(24(29)28-13-3-2-4-22(28)27-23)14-20(15-26)34(30,31)19-11-5-16(25)6-12-19/h2-14H,1H3 |
| InChIKey | YPHJCPDDOCPTFU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.93 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|