C21H22N4O4S3 — CID 18805592
(5E)-3-(1,1-dioxothiolan-3-yl)-5-[(7-methyl-4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18805592) has the molecular formula C21H22N4O4S3 and a molecular weight of 490.63 g/mol. Its IUPAC name is (5E)-3-(1,1-dioxothiolan-3-yl)-5-[(7-methyl-4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(1,1-dioxothiolan-3-yl)-5-[(7-methyl-4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18805592 |
| Molecular Formula | C21H22N4O4S3 |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | (5E)-3-(1,1-dioxothiolan-3-yl)-5-[(7-methyl-4-oxo-2-pyrrolidin-1-ylpyrido[1,2-a]pyrimidin-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc2nc(N3CCCC3)c(/C=C3/SC(=S)N(C4CCS(=O)(=O)C4)C3=O)c(=O)n2c1 |
| InChI | InChI=1S/C21H22N4O4S3/c1-13-4-5-17-22-18(23-7-2-3-8-23)15(19(26)24(17)11-13)10-16-20(27)25(21(30)31-16)14-6-9-32(28,29)12-14/h4-5,10-11,14H,2-3,6-9,12H2,1H3/b16-10+ |
| InChIKey | VHTOMPZIMPYRAK-MHWRWJLKSA-N |
| XLogP | 1.99 |
| TPSA | 92.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|