C23H27N5O5S3 — CID 5117980
3-(1,1-dioxothiolan-3-yl)-5-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5117980) has the molecular formula C23H27N5O5S3 and a molecular weight of 549.70 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-5-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-5-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5117980 |
| Molecular Formula | C23H27N5O5S3 |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-5-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cccn2c(=O)c(C=C3SC(=S)N(C4CCS(=O)(=O)C4)C3=O)c(N3CCN(CCO)CC3)nc12 |
| InChI | InChI=1S/C23H27N5O5S3/c1-15-3-2-5-27-19(15)24-20(26-8-6-25(7-9-26)10-11-29)17(21(27)30)13-18-22(31)28(23(34)35-18)16-4-12-36(32,33)14-16/h2-3,5,13,16,29H,4,6-12,14H2,1H3 |
| InChIKey | FOPHFQPVUWTAJZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|