C24H28N4O4S3 — CID 3351463
3-(1,1-dioxothiolan-3-yl)-5-[[2-(2-ethylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3351463) has the molecular formula C24H28N4O4S3 and a molecular weight of 532.71 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-5-[[2-(2-ethylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-5-[[2-(2-ethylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3351463 |
| Molecular Formula | C24H28N4O4S3 |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-5-[[2-(2-ethylpiperidin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCC1CCCCN1c1nc2c(C)cccn2c(=O)c1C=C1SC(=S)N(C2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C24H28N4O4S3/c1-3-16-8-4-5-10-26(16)21-18(22(29)27-11-6-7-15(2)20(27)25-21)13-19-23(30)28(24(33)34-19)17-9-12-35(31,32)14-17/h6-7,11,13,16-17H,3-5,8-10,12,14H2,1-2H3 |
| InChIKey | RVOHPGJKAIYRBA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 92.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|